C13H18FN — CID 89299112
(3Z,5E,8Z)-5-fluoro-1,8-dimethyl-2-methylidene-1-azacycloundeca-3,5,8-triene (PubChem CID 89299112) has the molecular formula C13H18FN and a molecular weight of 207.29 g/mol. Its IUPAC name is (3Z,5E,8Z)-5-fluoro-1,8-dimethyl-2-methylidene-1-azacycloundeca-3,5,8-triene.
| Compound Name | (3Z,5E,8Z)-5-fluoro-1,8-dimethyl-2-methylidene-1-azacycloundeca-3,5,8-triene |
|---|---|
| PubChem CID | 89299112 |
| Molecular Formula | C13H18FN |
| Molecular Weight | 207.29 g/mol |
| Exact Mass | 207.14 |
| IUPAC Name | (3Z,5E,8Z)-5-fluoro-1,8-dimethyl-2-methylidene-1-azacycloundeca-3,5,8-triene |
| SMILES | C=C1/C=C\C(F)=C/C/C(C)=C\CCN1C |
| InChI | InChI=1S/C13H18FN/c1-11-5-4-10-15(3)12(2)7-9-13(14)8-6-11/h5,7-9H,2,4,6,10H2,1,3H3/b9-7-,11-5-,13-8+ |
| InChIKey | BQXRCGUFHUMSOD-DFWUFGAXSA-N |
| XLogP | 3.58 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.29 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|