C12H14F6O — CID 89299198
2,6-bis(1,1,1-trifluoropropan-2-yl)cyclohexa-2,4-dien-1-ol (PubChem CID 89299198) has the molecular formula C12H14F6O and a molecular weight of 288.23 g/mol. Its IUPAC name is 2,6-bis(1,1,1-trifluoropropan-2-yl)cyclohexa-2,4-dien-1-ol.
| Compound Name | 2,6-bis(1,1,1-trifluoropropan-2-yl)cyclohexa-2,4-dien-1-ol |
|---|---|
| PubChem CID | 89299198 |
| Molecular Formula | C12H14F6O |
| Molecular Weight | 288.23 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 2,6-bis(1,1,1-trifluoropropan-2-yl)cyclohexa-2,4-dien-1-ol |
| SMILES | CC(C1=CC=CC(C(C)C(F)(F)F)C1O)C(F)(F)F |
| InChI | InChI=1S/C12H14F6O/c1-6(11(13,14)15)8-4-3-5-9(10(8)19)7(2)12(16,17)18/h3-8,10,19H,1-2H3 |
| InChIKey | WZTMZUDZUBQGRM-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.23 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |