C15H22O4 — CID 89299420
8-(2-hydroxybut-3-en-2-yl)-6,7,9-trimethyl-1,4-dioxaspiro[4.5]deca-6,9-dien-8-ol (PubChem CID 89299420) has the molecular formula C15H22O4 and a molecular weight of 266.34 g/mol. Its IUPAC name is 8-(2-hydroxybut-3-en-2-yl)-6,7,9-trimethyl-1,4-dioxaspiro[4.5]deca-6,9-dien-8-ol.
| Compound Name | 8-(2-hydroxybut-3-en-2-yl)-6,7,9-trimethyl-1,4-dioxaspiro[4.5]deca-6,9-dien-8-ol |
|---|---|
| PubChem CID | 89299420 |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 8-(2-hydroxybut-3-en-2-yl)-6,7,9-trimethyl-1,4-dioxaspiro[4.5]deca-6,9-dien-8-ol |
| SMILES | C=CC(C)(O)C1(O)C(C)=CC2(OCCO2)C(C)=C1C |
| InChI | InChI=1S/C15H22O4/c1-6-13(5,16)15(17)10(2)9-14(11(3)12(15)4)18-7-8-19-14/h6,9,16-17H,1,7-8H2,2-5H3 |
| InChIKey | KIPARIIEAHPJHS-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|