About (2Z)-3-methyl-2-propylidene-1,3-thiazolidine
(2Z)-3-methyl-2-propylidene-1,3-thiazolidine (PubChem CID 89300163) has the molecular formula C7H13NS
and a molecular weight of 143.25 g/mol. Its IUPAC name is (2Z)-3-methyl-2-propylidene-1,3-thiazolidine.
Molecular Properties
| Compound Name | (2Z)-3-methyl-2-propylidene-1,3-thiazolidine |
| PubChem CID | 89300163 |
| Molecular Formula | C7H13NS |
| Molecular Weight | 143.25 g/mol |
| Exact Mass | 143.08 |
| IUPAC Name | (2Z)-3-methyl-2-propylidene-1,3-thiazolidine |
| SMILES | CC/C=C1\SCCN1C |
| InChI | InChI=1S/C7H13NS/c1-3-4-7-8(2)5-6-9-7/h4H,3,5-6H2,1-2H3/b7-4- |
| InChIKey | HEBHFZAOZCRLCI-DAXSKMNVSA-N |
| XLogP | 1.92 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.25 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2Z)-3-methyl-2-propylidene-1,3-thiazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-3-methyl-2-propylidene-1,3-thiazolidine?
The IUPAC name of (2Z)-3-methyl-2-propylidene-1,3-thiazolidine (CID 89300163) is (2Z)-3-methyl-2-propylidene-1,3-thiazolidine.
What is the SMILES notation for (2Z)-3-methyl-2-propylidene-1,3-thiazolidine?
The canonical SMILES for (2Z)-3-methyl-2-propylidene-1,3-thiazolidine is CC/C=C1\SCCN1C.
What is the InChIKey of (2Z)-3-methyl-2-propylidene-1,3-thiazolidine?
The InChIKey is HEBHFZAOZCRLCI-DAXSKMNVSA-N. The full InChI is InChI=1S/C7H13NS/c1-3-4-7-8(2)5-6-9-7/h4H,3,5-6H2,1-2H3/b7-4-.
What are the key properties of (2Z)-3-methyl-2-propylidene-1,3-thiazolidine?
(2Z)-3-methyl-2-propylidene-1,3-thiazolidine has a molecular weight of 143.25 g/mol, XLogP of 1.92, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-3-methyl-2-propylidene-1,3-thiazolidine is sourced from PubChem (CID 89300163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).