About 4,7-difluoro-3a,7a-dihydro-1H-benzimidazole
4,7-difluoro-3a,7a-dihydro-1H-benzimidazole (PubChem CID 89300197) has the molecular formula C7H6F2N2
and a molecular weight of 156.13 g/mol. Its IUPAC name is 4,7-difluoro-3a,7a-dihydro-1H-benzimidazole.
Molecular Properties
| Compound Name | 4,7-difluoro-3a,7a-dihydro-1H-benzimidazole |
| PubChem CID | 89300197 |
| Molecular Formula | C7H6F2N2 |
| Molecular Weight | 156.13 g/mol |
| Exact Mass | 156.05 |
| IUPAC Name | 4,7-difluoro-3a,7a-dihydro-1H-benzimidazole |
| SMILES | FC1=CC=C(F)C2NC=NC12 |
| InChI | InChI=1S/C7H6F2N2/c8-4-1-2-5(9)7-6(4)10-3-11-7/h1-3,6-7H,(H,10,11) |
| InChIKey | RUUUPYYIFNNTQO-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.13 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4,7-difluoro-3a,7a-dihydro-1H-benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,7-difluoro-3a,7a-dihydro-1H-benzimidazole?
The IUPAC name of 4,7-difluoro-3a,7a-dihydro-1H-benzimidazole (CID 89300197) is 4,7-difluoro-3a,7a-dihydro-1H-benzimidazole.
What is the SMILES notation for 4,7-difluoro-3a,7a-dihydro-1H-benzimidazole?
The canonical SMILES for 4,7-difluoro-3a,7a-dihydro-1H-benzimidazole is FC1=CC=C(F)C2NC=NC12.
What is the InChIKey of 4,7-difluoro-3a,7a-dihydro-1H-benzimidazole?
The InChIKey is RUUUPYYIFNNTQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6F2N2/c8-4-1-2-5(9)7-6(4)10-3-11-7/h1-3,6-7H,(H,10,11).
What are the key properties of 4,7-difluoro-3a,7a-dihydro-1H-benzimidazole?
4,7-difluoro-3a,7a-dihydro-1H-benzimidazole has a molecular weight of 156.13 g/mol, XLogP of 1.08, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,7-difluoro-3a,7a-dihydro-1H-benzimidazole is sourced from PubChem (CID 89300197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).