C13H4BrCl3N4 — CID 89300280
2-[(5-bromo-2-pyridinyl)amino]-3,5,6-trichlorobenzene-1,4-dicarbonitrile (PubChem CID 89300280) has the molecular formula C13H4BrCl3N4 and a molecular weight of 402.47 g/mol. Its IUPAC name is 2-[(5-bromo-2-pyridinyl)amino]-3,5,6-trichlorobenzene-1,4-dicarbonitrile.
| Compound Name | 2-[(5-bromo-2-pyridinyl)amino]-3,5,6-trichlorobenzene-1,4-dicarbonitrile |
|---|---|
| PubChem CID | 89300280 |
| Molecular Formula | C13H4BrCl3N4 |
| Molecular Weight | 402.47 g/mol |
| Exact Mass | 399.87 |
| IUPAC Name | 2-[(5-bromo-2-pyridinyl)amino]-3,5,6-trichlorobenzene-1,4-dicarbonitrile |
| SMILES | N#Cc1c(Cl)c(Cl)c(C#N)c(Nc2ccc(Br)cn2)c1Cl |
| InChI | InChI=1S/C13H4BrCl3N4/c14-6-1-2-9(20-5-6)21-13-8(4-19)11(16)10(15)7(3-18)12(13)17/h1-2,5H,(H,20,21) |
| InChIKey | STNOANOWJFFVGJ-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 72.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.47 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|