C23H25F3N4O3 — CID 89300616
prop-1-en-2-yl N-[(2R)-4-[3-(3-cyclopropylpyrazol-1-yl)azetidin-1-yl]-4-oxo-1-(2,4,5-trifluorophenyl)butan-2-yl]carbamate (PubChem CID 89300616) has the molecular formula C23H25F3N4O3 and a molecular weight of 462.47 g/mol. Its IUPAC name is prop-1-en-2-yl N-[(2R)-4-[3-(3-cyclopropylpyrazol-1-yl)azetidin-1-yl]-4-oxo-1-(2,4,5-trifluorophenyl)butan-2-yl]carbamate.
| Compound Name | prop-1-en-2-yl N-[(2R)-4-[3-(3-cyclopropylpyrazol-1-yl)azetidin-1-yl]-4-oxo-1-(2,4,5-trifluorophenyl)butan-2-yl]carbamate |
|---|---|
| PubChem CID | 89300616 |
| Molecular Formula | C23H25F3N4O3 |
| Molecular Weight | 462.47 g/mol |
| Exact Mass | 462.19 |
| IUPAC Name | prop-1-en-2-yl N-[(2R)-4-[3-(3-cyclopropylpyrazol-1-yl)azetidin-1-yl]-4-oxo-1-(2,4,5-trifluorophenyl)butan-2-yl]carbamate |
| SMILES | C=C(C)OC(=O)N[C@@H](CC(=O)N1CC(n2ccc(C3CC3)n2)C1)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C23H25F3N4O3/c1-13(2)33-23(32)27-16(7-15-8-19(25)20(26)10-18(15)24)9-22(31)29-11-17(12-29)30-6-5-21(28-30)14-3-4-14/h5-6,8,10,14,16-17H,1,3-4,7,9,11-12H2,2H3,(H,27,32)/t16-/m1/s1 |
| InChIKey | ZKCUDOAYNSHVRW-MRXNPFEDSA-N |
| XLogP | 3.82 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.47 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|