About 5-amino-2,3-dimethyl-2,3-dihydrofuran-4-carboxamide
5-amino-2,3-dimethyl-2,3-dihydrofuran-4-carboxamide (PubChem CID 89300672) has the molecular formula C7H12N2O2
and a molecular weight of 156.18 g/mol. Its IUPAC name is 5-amino-2,3-dimethyl-2,3-dihydrofuran-4-carboxamide.
Molecular Properties
| Compound Name | 5-amino-2,3-dimethyl-2,3-dihydrofuran-4-carboxamide |
| PubChem CID | 89300672 |
| Molecular Formula | C7H12N2O2 |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.09 |
| IUPAC Name | 5-amino-2,3-dimethyl-2,3-dihydrofuran-4-carboxamide |
| SMILES | CC1OC(N)=C(C(N)=O)C1C |
| InChI | InChI=1S/C7H12N2O2/c1-3-4(2)11-7(9)5(3)6(8)10/h3-4H,9H2,1-2H3,(H2,8,10) |
| InChIKey | NSYGNGBNOZZEPG-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-amino-2,3-dimethyl-2,3-dihydrofuran-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-2,3-dimethyl-2,3-dihydrofuran-4-carboxamide?
The IUPAC name of 5-amino-2,3-dimethyl-2,3-dihydrofuran-4-carboxamide (CID 89300672) is 5-amino-2,3-dimethyl-2,3-dihydrofuran-4-carboxamide.
What is the SMILES notation for 5-amino-2,3-dimethyl-2,3-dihydrofuran-4-carboxamide?
The canonical SMILES for 5-amino-2,3-dimethyl-2,3-dihydrofuran-4-carboxamide is CC1OC(N)=C(C(N)=O)C1C.
What is the InChIKey of 5-amino-2,3-dimethyl-2,3-dihydrofuran-4-carboxamide?
The InChIKey is NSYGNGBNOZZEPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2O2/c1-3-4(2)11-7(9)5(3)6(8)10/h3-4H,9H2,1-2H3,(H2,8,10).
What are the key properties of 5-amino-2,3-dimethyl-2,3-dihydrofuran-4-carboxamide?
5-amino-2,3-dimethyl-2,3-dihydrofuran-4-carboxamide has a molecular weight of 156.18 g/mol, XLogP of -0.30, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-2,3-dimethyl-2,3-dihydrofuran-4-carboxamide is sourced from PubChem (CID 89300672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).