C18H23F3O2 — CID 89300743
(5Z,6Z)-5-prop-2-enylidene-6-[2-[5-(trifluoromethoxy)pentoxy]propylidene]cyclohexa-1,3-diene (PubChem CID 89300743) has the molecular formula C18H23F3O2 and a molecular weight of 328.37 g/mol. Its IUPAC name is (5Z,6Z)-5-prop-2-enylidene-6-[2-[5-(trifluoromethoxy)pentoxy]propylidene]cyclohexa-1,3-diene.
| Compound Name | (5Z,6Z)-5-prop-2-enylidene-6-[2-[5-(trifluoromethoxy)pentoxy]propylidene]cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 89300743 |
| Molecular Formula | C18H23F3O2 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | (5Z,6Z)-5-prop-2-enylidene-6-[2-[5-(trifluoromethoxy)pentoxy]propylidene]cyclohexa-1,3-diene |
| SMILES | C=C/C=c1/cccc/c1=C/C(C)OCCCCCOC(F)(F)F |
| InChI | InChI=1S/C18H23F3O2/c1-3-9-16-10-5-6-11-17(16)14-15(2)22-12-7-4-8-13-23-18(19,20)21/h3,5-6,9-11,14-15H,1,4,7-8,12-13H2,2H3/b16-9-,17-14- |
| InChIKey | HLTJQPHPRQBACQ-YNEQSQDESA-N |
| XLogP | 3.55 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|