C7H11NO2 — CID 89301068
(6S,7aS)-6-methyl-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-one (PubChem CID 89301068) has the molecular formula C7H11NO2 and a molecular weight of 141.17 g/mol. Its IUPAC name is (6S,7aS)-6-methyl-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-one.
| Compound Name | (6S,7aS)-6-methyl-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-one |
|---|---|
| PubChem CID | 89301068 |
| Molecular Formula | C7H11NO2 |
| Molecular Weight | 141.17 g/mol |
| Exact Mass | 141.08 |
| IUPAC Name | (6S,7aS)-6-methyl-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-one |
| SMILES | C[C@H]1C[C@H]2COCN2C1=O |
| InChI | InChI=1S/C7H11NO2/c1-5-2-6-3-10-4-8(6)7(5)9/h5-6H,2-4H2,1H3/t5-,6-/m0/s1 |
| InChIKey | NOXCGAKPUHTILE-WDSKDSINSA-N |
| XLogP | 0.21 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.17 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |