C20H27F3O2 — CID 89301083
(5Z,6Z)-5-prop-2-enylidene-6-[2-[5-(3,3,3-trifluoropropoxy)pentoxy]propylidene]cyclohexa-1,3-diene (PubChem CID 89301083) has the molecular formula C20H27F3O2 and a molecular weight of 356.43 g/mol. Its IUPAC name is (5Z,6Z)-5-prop-2-enylidene-6-[2-[5-(3,3,3-trifluoropropoxy)pentoxy]propylidene]cyclohexa-1,3-diene.
| Compound Name | (5Z,6Z)-5-prop-2-enylidene-6-[2-[5-(3,3,3-trifluoropropoxy)pentoxy]propylidene]cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 89301083 |
| Molecular Formula | C20H27F3O2 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | (5Z,6Z)-5-prop-2-enylidene-6-[2-[5-(3,3,3-trifluoropropoxy)pentoxy]propylidene]cyclohexa-1,3-diene |
| SMILES | C=C/C=c1/cccc/c1=C/C(C)OCCCCCOCCC(F)(F)F |
| InChI | InChI=1S/C20H27F3O2/c1-3-9-18-10-5-6-11-19(18)16-17(2)25-14-8-4-7-13-24-15-12-20(21,22)23/h3,5-6,9-11,16-17H,1,4,7-8,12-15H2,2H3/b18-9-,19-16- |
| InChIKey | IRTREDULYHDDRC-QQCAKMJESA-N |
| XLogP | 3.98 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|