C11H11Cl2NO3 — CID 893011
(2S)-N-(3,5-dichloro-4-hydroxyphenyl)oxolane-2-carboxamide (PubChem CID 893011) has the molecular formula C11H11Cl2NO3 and a molecular weight of 276.12 g/mol. Its IUPAC name is (2S)-N-(3,5-dichloro-4-hydroxyphenyl)oxolane-2-carboxamide.
| Compound Name | (2S)-N-(3,5-dichloro-4-hydroxyphenyl)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 893011 |
| Molecular Formula | C11H11Cl2NO3 |
| Molecular Weight | 276.12 g/mol |
| Exact Mass | 275.01 |
| IUPAC Name | (2S)-N-(3,5-dichloro-4-hydroxyphenyl)oxolane-2-carboxamide |
| SMILES | O=C(Nc1cc(Cl)c(O)c(Cl)c1)[C@@H]1CCCO1 |
| InChI | InChI=1S/C11H11Cl2NO3/c12-7-4-6(5-8(13)10(7)15)14-11(16)9-2-1-3-17-9/h4-5,9,15H,1-3H2,(H,14,16)/t9-/m0/s1 |
| InChIKey | IQGOWYFXCFHXNR-VIFPVBQESA-N |
| XLogP | 2.82 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.12 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|