About (3E,5E)-3-azido-6-methylocta-3,5-diene
(3E,5E)-3-azido-6-methylocta-3,5-diene (PubChem CID 89301366) has the molecular formula C9H15N3
and a molecular weight of 165.24 g/mol. Its IUPAC name is (3E,5E)-3-azido-6-methylocta-3,5-diene.
Molecular Properties
| Compound Name | (3E,5E)-3-azido-6-methylocta-3,5-diene |
| PubChem CID | 89301366 |
| Molecular Formula | C9H15N3 |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.13 |
| IUPAC Name | (3E,5E)-3-azido-6-methylocta-3,5-diene |
| SMILES | CC/C(C)=C/C=C(\CC)N=[N+]=[N-] |
| InChI | InChI=1S/C9H15N3/c1-4-8(3)6-7-9(5-2)11-12-10/h6-7H,4-5H2,1-3H3/b8-6+,9-7+ |
| InChIKey | ZIWLMBKRAXKUSL-CDJQDVQCSA-N |
| XLogP | 3.95 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze (3E,5E)-3-azido-6-methylocta-3,5-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E,5E)-3-azido-6-methylocta-3,5-diene?
The IUPAC name of (3E,5E)-3-azido-6-methylocta-3,5-diene (CID 89301366) is (3E,5E)-3-azido-6-methylocta-3,5-diene.
What is the SMILES notation for (3E,5E)-3-azido-6-methylocta-3,5-diene?
The canonical SMILES for (3E,5E)-3-azido-6-methylocta-3,5-diene is CC/C(C)=C/C=C(\CC)N=[N+]=[N-].
What is the InChIKey of (3E,5E)-3-azido-6-methylocta-3,5-diene?
The InChIKey is ZIWLMBKRAXKUSL-CDJQDVQCSA-N. The full InChI is InChI=1S/C9H15N3/c1-4-8(3)6-7-9(5-2)11-12-10/h6-7H,4-5H2,1-3H3/b8-6+,9-7+.
What are the key properties of (3E,5E)-3-azido-6-methylocta-3,5-diene?
(3E,5E)-3-azido-6-methylocta-3,5-diene has a molecular weight of 165.24 g/mol, XLogP of 3.95, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3E,5E)-3-azido-6-methylocta-3,5-diene is sourced from PubChem (CID 89301366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).