C10H14O4 — CID 89301905
methyl (2S,4E,6Z)-2,8-dihydroxynona-4,6,8-trienoate (PubChem CID 89301905) has the molecular formula C10H14O4 and a molecular weight of 198.22 g/mol. Its IUPAC name is methyl (2S,4E,6Z)-2,8-dihydroxynona-4,6,8-trienoate.
| Compound Name | methyl (2S,4E,6Z)-2,8-dihydroxynona-4,6,8-trienoate |
|---|---|
| PubChem CID | 89301905 |
| Molecular Formula | C10H14O4 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | methyl (2S,4E,6Z)-2,8-dihydroxynona-4,6,8-trienoate |
| SMILES | C=C(O)/C=C\C=C\C[C@H](O)C(=O)OC |
| InChI | InChI=1S/C10H14O4/c1-8(11)6-4-3-5-7-9(12)10(13)14-2/h3-6,9,11-12H,1,7H2,2H3/b5-3+,6-4-/t9-/m0/s1 |
| InChIKey | ZZTXPUPWCXTTKD-TXZYQSTASA-N |
| XLogP | 1.09 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|