About 4-(4-bromocyclohexa-1,3-dien-1-yl)cyclohexa-1,3-dien-1-amine
4-(4-bromocyclohexa-1,3-dien-1-yl)cyclohexa-1,3-dien-1-amine (PubChem CID 89302019) has the molecular formula C12H14BrN
and a molecular weight of 252.15 g/mol. Its IUPAC name is 4-(4-bromocyclohexa-1,3-dien-1-yl)cyclohexa-1,3-dien-1-amine.
Molecular Properties
| Compound Name | 4-(4-bromocyclohexa-1,3-dien-1-yl)cyclohexa-1,3-dien-1-amine |
| PubChem CID | 89302019 |
| Molecular Formula | C12H14BrN |
| Molecular Weight | 252.15 g/mol |
| Exact Mass | 251.03 |
| IUPAC Name | 4-(4-bromocyclohexa-1,3-dien-1-yl)cyclohexa-1,3-dien-1-amine |
| SMILES | NC1=CC=C(C2=CC=C(Br)CC2)CC1 |
| InChI | InChI=1S/C12H14BrN/c13-11-5-1-9(2-6-11)10-3-7-12(14)8-4-10/h1,3,5,7H,2,4,6,8,14H2 |
| InChIKey | XYYXNHPSESGHCD-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.15 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-(4-bromocyclohexa-1,3-dien-1-yl)cyclohexa-1,3-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-bromocyclohexa-1,3-dien-1-yl)cyclohexa-1,3-dien-1-amine?
The IUPAC name of 4-(4-bromocyclohexa-1,3-dien-1-yl)cyclohexa-1,3-dien-1-amine (CID 89302019) is 4-(4-bromocyclohexa-1,3-dien-1-yl)cyclohexa-1,3-dien-1-amine.
What is the SMILES notation for 4-(4-bromocyclohexa-1,3-dien-1-yl)cyclohexa-1,3-dien-1-amine?
The canonical SMILES for 4-(4-bromocyclohexa-1,3-dien-1-yl)cyclohexa-1,3-dien-1-amine is NC1=CC=C(C2=CC=C(Br)CC2)CC1.
What is the InChIKey of 4-(4-bromocyclohexa-1,3-dien-1-yl)cyclohexa-1,3-dien-1-amine?
The InChIKey is XYYXNHPSESGHCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14BrN/c13-11-5-1-9(2-6-11)10-3-7-12(14)8-4-10/h1,3,5,7H,2,4,6,8,14H2.
What are the key properties of 4-(4-bromocyclohexa-1,3-dien-1-yl)cyclohexa-1,3-dien-1-amine?
4-(4-bromocyclohexa-1,3-dien-1-yl)cyclohexa-1,3-dien-1-amine has a molecular weight of 252.15 g/mol, XLogP of 3.55, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-bromocyclohexa-1,3-dien-1-yl)cyclohexa-1,3-dien-1-amine is sourced from PubChem (CID 89302019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).