About N'-(2-aminoethyl)-N'-iodoethane-1,2-diamine
N'-(2-aminoethyl)-N'-iodoethane-1,2-diamine (PubChem CID 89302639) has the molecular formula C4H12IN3
and a molecular weight of 229.06 g/mol. Its IUPAC name is N'-(2-aminoethyl)-N'-iodoethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-(2-aminoethyl)-N'-iodoethane-1,2-diamine |
| PubChem CID | 89302639 |
| Molecular Formula | C4H12IN3 |
| Molecular Weight | 229.06 g/mol |
| Exact Mass | 229.01 |
| IUPAC Name | N'-(2-aminoethyl)-N'-iodoethane-1,2-diamine |
| SMILES | NCCN(I)CCN |
| InChI | InChI=1S/C4H12IN3/c5-8(3-1-6)4-2-7/h1-4,6-7H2 |
| InChIKey | GNYAUZTWORSOSQ-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.06 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze N'-(2-aminoethyl)-N'-iodoethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(2-aminoethyl)-N'-iodoethane-1,2-diamine?
The IUPAC name of N'-(2-aminoethyl)-N'-iodoethane-1,2-diamine (CID 89302639) is N'-(2-aminoethyl)-N'-iodoethane-1,2-diamine.
What is the SMILES notation for N'-(2-aminoethyl)-N'-iodoethane-1,2-diamine?
The canonical SMILES for N'-(2-aminoethyl)-N'-iodoethane-1,2-diamine is NCCN(I)CCN.
What is the InChIKey of N'-(2-aminoethyl)-N'-iodoethane-1,2-diamine?
The InChIKey is GNYAUZTWORSOSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H12IN3/c5-8(3-1-6)4-2-7/h1-4,6-7H2.
What are the key properties of N'-(2-aminoethyl)-N'-iodoethane-1,2-diamine?
N'-(2-aminoethyl)-N'-iodoethane-1,2-diamine has a molecular weight of 229.06 g/mol, XLogP of -0.44, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(2-aminoethyl)-N'-iodoethane-1,2-diamine is sourced from PubChem (CID 89302639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).