C15H22BrN2O+ — CID 8930273
N-(3-bromophenyl)-2-[(3S,5S)-3,5-dimethylpiperidin-1-ium-1-yl]acetamide (PubChem CID 8930273) has the molecular formula C15H22BrN2O+ and a molecular weight of 326.26 g/mol. Its IUPAC name is N-(3-bromophenyl)-2-[(3S,5S)-3,5-dimethylpiperidin-1-ium-1-yl]acetamide.
| Compound Name | N-(3-bromophenyl)-2-[(3S,5S)-3,5-dimethylpiperidin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 8930273 |
| Molecular Formula | C15H22BrN2O+ |
| Molecular Weight | 326.26 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | N-(3-bromophenyl)-2-[(3S,5S)-3,5-dimethylpiperidin-1-ium-1-yl]acetamide |
| SMILES | C[C@H]1C[C@H](C)C[NH+](CC(=O)Nc2cccc(Br)c2)C1 |
| InChI | InChI=1S/C15H21BrN2O/c1-11-6-12(2)9-18(8-11)10-15(19)17-14-5-3-4-13(16)7-14/h3-5,7,11-12H,6,8-10H2,1-2H3,(H,17,19)/p+1/t11-,12-/m0/s1 |
| InChIKey | VUMKFCSFHXPLML-RYUDHWBXSA-O |
| XLogP | 1.95 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.26 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |