C23H30BrCl2NO3 — CID 89302733
(Z)-7-[(1S,2R)-4-bromo-3-chloro-2-[2-[2-chloro-6-(prop-1-en-2-yloxymethyl)-4-pyridinyl]ethyl]cyclopentyl]hept-5-enoic acid (PubChem CID 89302733) has the molecular formula C23H30BrCl2NO3 and a molecular weight of 519.31 g/mol. Its IUPAC name is (Z)-7-[(1S,2R)-4-bromo-3-chloro-2-[2-[2-chloro-6-(prop-1-en-2-yloxymethyl)-4-pyridinyl]ethyl]cyclopentyl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1S,2R)-4-bromo-3-chloro-2-[2-[2-chloro-6-(prop-1-en-2-yloxymethyl)-4-pyridinyl]ethyl]cyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 89302733 |
| Molecular Formula | C23H30BrCl2NO3 |
| Molecular Weight | 519.31 g/mol |
| Exact Mass | 517.08 |
| IUPAC Name | (Z)-7-[(1S,2R)-4-bromo-3-chloro-2-[2-[2-chloro-6-(prop-1-en-2-yloxymethyl)-4-pyridinyl]ethyl]cyclopentyl]hept-5-enoic acid |
| SMILES | C=C(C)OCc1cc(CC[C@H]2C(Cl)C(Br)C[C@@H]2C/C=C\CCCC(=O)O)cc(Cl)n1 |
| InChI | InChI=1S/C23H30BrCl2NO3/c1-15(2)30-14-18-11-16(12-21(25)27-18)9-10-19-17(13-20(24)23(19)26)7-5-3-4-6-8-22(28)29/h3,5,11-12,17,19-20,23H,1,4,6-10,13-14H2,2H3,(H,28,29)/b5-3-/t17-,19+,20?,23?/m0/s1 |
| InChIKey | YBYBVEGVIZJZLF-ULLBZBDNSA-N |
| XLogP | 6.93 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.31 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|