C9H17NO6 — CID 89302810
N-[(2S,4R)-2,3,4,5,6-pentahydroxyhexyl]prop-2-enamide (PubChem CID 89302810) has the molecular formula C9H17NO6 and a molecular weight of 235.24 g/mol. Its IUPAC name is N-[(2S,4R)-2,3,4,5,6-pentahydroxyhexyl]prop-2-enamide.
| Compound Name | N-[(2S,4R)-2,3,4,5,6-pentahydroxyhexyl]prop-2-enamide |
|---|---|
| PubChem CID | 89302810 |
| Molecular Formula | C9H17NO6 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | N-[(2S,4R)-2,3,4,5,6-pentahydroxyhexyl]prop-2-enamide |
| SMILES | C=CC(=O)NC[C@H](O)C(O)[C@H](O)C(O)CO |
| InChI | InChI=1S/C9H17NO6/c1-2-7(14)10-3-5(12)8(15)9(16)6(13)4-11/h2,5-6,8-9,11-13,15-16H,1,3-4H2,(H,10,14)/t5-,6?,8?,9+/m0/s1 |
| InChIKey | VOXLHYBRLWBDHW-FKZRYFBQSA-N |
| XLogP | -3.28 |
| TPSA | 130.25 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | -3.28 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|