About [(4S)-1,3-thiazolidin-4-yl]methanediol
[(4S)-1,3-thiazolidin-4-yl]methanediol (PubChem CID 89302942) has the molecular formula C4H9NO2S
and a molecular weight of 135.19 g/mol. Its IUPAC name is [(4S)-1,3-thiazolidin-4-yl]methanediol.
Molecular Properties
| Compound Name | [(4S)-1,3-thiazolidin-4-yl]methanediol |
| PubChem CID | 89302942 |
| Molecular Formula | C4H9NO2S |
| Molecular Weight | 135.19 g/mol |
| Exact Mass | 135.04 |
| IUPAC Name | [(4S)-1,3-thiazolidin-4-yl]methanediol |
| SMILES | OC(O)[C@H]1CSCN1 |
| InChI | InChI=1S/C4H9NO2S/c6-4(7)3-1-8-2-5-3/h3-7H,1-2H2/t3-/m1/s1 |
| InChIKey | XAMDDYONZYJNPX-GSVOUGTGSA-N |
| XLogP | -1.04 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.19 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze [(4S)-1,3-thiazolidin-4-yl]methanediol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4S)-1,3-thiazolidin-4-yl]methanediol?
The IUPAC name of [(4S)-1,3-thiazolidin-4-yl]methanediol (CID 89302942) is [(4S)-1,3-thiazolidin-4-yl]methanediol.
What is the SMILES notation for [(4S)-1,3-thiazolidin-4-yl]methanediol?
The canonical SMILES for [(4S)-1,3-thiazolidin-4-yl]methanediol is OC(O)[C@H]1CSCN1.
What is the InChIKey of [(4S)-1,3-thiazolidin-4-yl]methanediol?
The InChIKey is XAMDDYONZYJNPX-GSVOUGTGSA-N. The full InChI is InChI=1S/C4H9NO2S/c6-4(7)3-1-8-2-5-3/h3-7H,1-2H2/t3-/m1/s1.
What are the key properties of [(4S)-1,3-thiazolidin-4-yl]methanediol?
[(4S)-1,3-thiazolidin-4-yl]methanediol has a molecular weight of 135.19 g/mol, XLogP of -1.04, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(4S)-1,3-thiazolidin-4-yl]methanediol is sourced from PubChem (CID 89302942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).