C28H64O2P2S5 — CID 89303212
1-hexylsulfanylhexane;bis(hydroxy-sulfanyl-sulfanylidene-(2,4,4-trimethylpentyl)-λ5-phosphane) (PubChem CID 89303212) has the molecular formula C28H64O2P2S5 and a molecular weight of 655.10 g/mol. Its IUPAC name is 1-hexylsulfanylhexane;bis(hydroxy-sulfanyl-sulfanylidene-(2,4,4-trimethylpentyl)-λ5-phosphane).
| Compound Name | 1-hexylsulfanylhexane;bis(hydroxy-sulfanyl-sulfanylidene-(2,4,4-trimethylpentyl)-λ5-phosphane) |
|---|---|
| PubChem CID | 89303212 |
| Molecular Formula | C28H64O2P2S5 |
| Molecular Weight | 655.10 g/mol |
| Exact Mass | 654.30 |
| IUPAC Name | 1-hexylsulfanylhexane;bis(hydroxy-sulfanyl-sulfanylidene-(2,4,4-trimethylpentyl)-λ5-phosphane) |
| SMILES | CC(CC(C)(C)C)CP(O)(=S)S.CC(CC(C)(C)C)CP(O)(=S)S.CCCCCCSCCCCCC |
| InChI | InChI=1S/C12H26S.2C8H19OPS2/c1-3-5-7-9-11-13-12-10-8-6-4-2;2*1-7(5-8(2,3)4)6-10(9,11)12/h3-12H2,1-2H3;2*7H,5-6H2,1-4H3,(H2,9,11,12) |
| InChIKey | HFKAHTGWOWOFAS-UHFFFAOYSA-N |
| XLogP | 11.46 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.10 |
| LogP ≤ 5 | 11.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|