About 5H-pyrrolo[2,3-d]pyrimidine-6-carboxamide
5H-pyrrolo[2,3-d]pyrimidine-6-carboxamide (PubChem CID 89303219) has the molecular formula C7H6N4O
and a molecular weight of 162.15 g/mol. Its IUPAC name is 5H-pyrrolo[2,3-d]pyrimidine-6-carboxamide.
Molecular Properties
| Compound Name | 5H-pyrrolo[2,3-d]pyrimidine-6-carboxamide |
| PubChem CID | 89303219 |
| Molecular Formula | C7H6N4O |
| Molecular Weight | 162.15 g/mol |
| Exact Mass | 162.05 |
| IUPAC Name | 5H-pyrrolo[2,3-d]pyrimidine-6-carboxamide |
| SMILES | NC(=O)C1=Nc2ncncc2C1 |
| InChI | InChI=1S/C7H6N4O/c8-6(12)5-1-4-2-9-3-10-7(4)11-5/h2-3H,1H2,(H2,8,12) |
| InChIKey | FYCONNCGUQHMRE-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 81.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.15 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5H-pyrrolo[2,3-d]pyrimidine-6-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5H-pyrrolo[2,3-d]pyrimidine-6-carboxamide?
The IUPAC name of 5H-pyrrolo[2,3-d]pyrimidine-6-carboxamide (CID 89303219) is 5H-pyrrolo[2,3-d]pyrimidine-6-carboxamide.
What is the SMILES notation for 5H-pyrrolo[2,3-d]pyrimidine-6-carboxamide?
The canonical SMILES for 5H-pyrrolo[2,3-d]pyrimidine-6-carboxamide is NC(=O)C1=Nc2ncncc2C1.
What is the InChIKey of 5H-pyrrolo[2,3-d]pyrimidine-6-carboxamide?
The InChIKey is FYCONNCGUQHMRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N4O/c8-6(12)5-1-4-2-9-3-10-7(4)11-5/h2-3H,1H2,(H2,8,12).
What are the key properties of 5H-pyrrolo[2,3-d]pyrimidine-6-carboxamide?
5H-pyrrolo[2,3-d]pyrimidine-6-carboxamide has a molecular weight of 162.15 g/mol, XLogP of -0.41, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5H-pyrrolo[2,3-d]pyrimidine-6-carboxamide is sourced from PubChem (CID 89303219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).