About [5-(2,4-difluorophenoxy)-1-(2-methylpropyl)indazol-6-yl] hydrogen carbonate
[5-(2,4-difluorophenoxy)-1-(2-methylpropyl)indazol-6-yl] hydrogen carbonate (PubChem CID 89303281) has the molecular formula C18H16F2N2O4
and a molecular weight of 362.33 g/mol. Its IUPAC name is [5-(2,4-difluorophenoxy)-1-(2-methylpropyl)indazol-6-yl] hydrogen carbonate.
Molecular Properties
| Compound Name | [5-(2,4-difluorophenoxy)-1-(2-methylpropyl)indazol-6-yl] hydrogen carbonate |
| PubChem CID | 89303281 |
| Molecular Formula | C18H16F2N2O4 |
| Molecular Weight | 362.33 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | [5-(2,4-difluorophenoxy)-1-(2-methylpropyl)indazol-6-yl] hydrogen carbonate |
| SMILES | CC(C)Cn1ncc2cc(Oc3ccc(F)cc3F)c(OC(=O)O)cc21 |
| InChI | InChI=1S/C18H16F2N2O4/c1-10(2)9-22-14-7-17(26-18(23)24)16(5-11(14)8-21-22)25-15-4-3-12(19)6-13(15)20/h3-8,10H,9H2,1-2H3,(H,23,24) |
| InChIKey | VNQBPLDJLNVHHB-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.33 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze [5-(2,4-difluorophenoxy)-1-(2-methylpropyl)indazol-6-yl] hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(2,4-difluorophenoxy)-1-(2-methylpropyl)indazol-6-yl] hydrogen carbonate?
The IUPAC name of [5-(2,4-difluorophenoxy)-1-(2-methylpropyl)indazol-6-yl] hydrogen carbonate (CID 89303281) is [5-(2,4-difluorophenoxy)-1-(2-methylpropyl)indazol-6-yl] hydrogen carbonate.
What is the SMILES notation for [5-(2,4-difluorophenoxy)-1-(2-methylpropyl)indazol-6-yl] hydrogen carbonate?
The canonical SMILES for [5-(2,4-difluorophenoxy)-1-(2-methylpropyl)indazol-6-yl] hydrogen carbonate is CC(C)Cn1ncc2cc(Oc3ccc(F)cc3F)c(OC(=O)O)cc21.
What is the InChIKey of [5-(2,4-difluorophenoxy)-1-(2-methylpropyl)indazol-6-yl] hydrogen carbonate?
The InChIKey is VNQBPLDJLNVHHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16F2N2O4/c1-10(2)9-22-14-7-17(26-18(23)24)16(5-11(14)8-21-22)25-15-4-3-12(19)6-13(15)20/h3-8,10H,9H2,1-2H3,(H,23,24).
What are the key properties of [5-(2,4-difluorophenoxy)-1-(2-methylpropyl)indazol-6-yl] hydrogen carbonate?
[5-(2,4-difluorophenoxy)-1-(2-methylpropyl)indazol-6-yl] hydrogen carbonate has a molecular weight of 362.33 g/mol, XLogP of 4.82, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(2,4-difluorophenoxy)-1-(2-methylpropyl)indazol-6-yl] hydrogen carbonate is sourced from PubChem (CID 89303281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).