About 3-chloro-5-(trifluoromethyl)phenol;ethyl 3-phenylpropanoate;3-phenylpropanoic acid
3-chloro-5-(trifluoromethyl)phenol;ethyl 3-phenylpropanoate;3-phenylpropanoic acid (PubChem CID 89303326) has the molecular formula C27H28ClF3O5
and a molecular weight of 524.96 g/mol. Its IUPAC name is 3-chloro-5-(trifluoromethyl)phenol;ethyl 3-phenylpropanoate;3-phenylpropanoic acid.
Molecular Properties
| Compound Name | 3-chloro-5-(trifluoromethyl)phenol;ethyl 3-phenylpropanoate;3-phenylpropanoic acid |
| PubChem CID | 89303326 |
| Molecular Formula | C27H28ClF3O5 |
| Molecular Weight | 524.96 g/mol |
| Exact Mass | 524.16 |
| IUPAC Name | 3-chloro-5-(trifluoromethyl)phenol;ethyl 3-phenylpropanoate;3-phenylpropanoic acid |
| SMILES | CCOC(=O)CCc1ccccc1.O=C(O)CCc1ccccc1.Oc1cc(Cl)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H14O2.C9H10O2.C7H4ClF3O/c1-2-13-11(12)9-8-10-6-4-3-5-7-10;10-9(11)7-6-8-4-2-1-3-5-8;8-5-1-4(7(9,10)11)2-6(12)3-5/h3-7H,2,8-9H2,1H3;1-5H,6-7H2,(H,10,11);1-3,12H |
| InChIKey | FHSURBCAYJMDQR-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 524.96 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-chloro-5-(trifluoromethyl)phenol;ethyl 3-phenylpropanoate;3-phenylpropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-5-(trifluoromethyl)phenol;ethyl 3-phenylpropanoate;3-phenylpropanoic acid?
The IUPAC name of 3-chloro-5-(trifluoromethyl)phenol;ethyl 3-phenylpropanoate;3-phenylpropanoic acid (CID 89303326) is 3-chloro-5-(trifluoromethyl)phenol;ethyl 3-phenylpropanoate;3-phenylpropanoic acid.
What is the SMILES notation for 3-chloro-5-(trifluoromethyl)phenol;ethyl 3-phenylpropanoate;3-phenylpropanoic acid?
The canonical SMILES for 3-chloro-5-(trifluoromethyl)phenol;ethyl 3-phenylpropanoate;3-phenylpropanoic acid is CCOC(=O)CCc1ccccc1.O=C(O)CCc1ccccc1.Oc1cc(Cl)cc(C(F)(F)F)c1.
What is the InChIKey of 3-chloro-5-(trifluoromethyl)phenol;ethyl 3-phenylpropanoate;3-phenylpropanoic acid?
The InChIKey is FHSURBCAYJMDQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O2.C9H10O2.C7H4ClF3O/c1-2-13-11(12)9-8-10-6-4-3-5-7-10;10-9(11)7-6-8-4-2-1-3-5-8;8-5-1-4(7(9,10)11)2-6(12)3-5/h3-7H,2,8-9H2,1H3;1-5H,6-7H2,(H,10,11);1-3,12H.
What are the key properties of 3-chloro-5-(trifluoromethyl)phenol;ethyl 3-phenylpropanoate;3-phenylpropanoic acid?
3-chloro-5-(trifluoromethyl)phenol;ethyl 3-phenylpropanoate;3-phenylpropanoic acid has a molecular weight of 524.96 g/mol, XLogP of 6.95, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-5-(trifluoromethyl)phenol;ethyl 3-phenylpropanoate;3-phenylpropanoic acid is sourced from PubChem (CID 89303326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).