About pyrrolo[3,2-b]pyridine-1-carboxamide
pyrrolo[3,2-b]pyridine-1-carboxamide (PubChem CID 89303380) has the molecular formula C8H7N3O
and a molecular weight of 161.16 g/mol. Its IUPAC name is pyrrolo[3,2-b]pyridine-1-carboxamide.
Molecular Properties
| Compound Name | pyrrolo[3,2-b]pyridine-1-carboxamide |
| PubChem CID | 89303380 |
| Molecular Formula | C8H7N3O |
| Molecular Weight | 161.16 g/mol |
| Exact Mass | 161.06 |
| IUPAC Name | pyrrolo[3,2-b]pyridine-1-carboxamide |
| SMILES | NC(=O)n1ccc2ncccc21 |
| InChI | InChI=1S/C8H7N3O/c9-8(12)11-5-3-6-7(11)2-1-4-10-6/h1-5H,(H2,9,12) |
| InChIKey | JTQKWGZNQLLTGR-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.16 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze pyrrolo[3,2-b]pyridine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrrolo[3,2-b]pyridine-1-carboxamide?
The IUPAC name of pyrrolo[3,2-b]pyridine-1-carboxamide (CID 89303380) is pyrrolo[3,2-b]pyridine-1-carboxamide.
What is the SMILES notation for pyrrolo[3,2-b]pyridine-1-carboxamide?
The canonical SMILES for pyrrolo[3,2-b]pyridine-1-carboxamide is NC(=O)n1ccc2ncccc21.
What is the InChIKey of pyrrolo[3,2-b]pyridine-1-carboxamide?
The InChIKey is JTQKWGZNQLLTGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N3O/c9-8(12)11-5-3-6-7(11)2-1-4-10-6/h1-5H,(H2,9,12).
What are the key properties of pyrrolo[3,2-b]pyridine-1-carboxamide?
pyrrolo[3,2-b]pyridine-1-carboxamide has a molecular weight of 161.16 g/mol, XLogP of 0.96, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pyrrolo[3,2-b]pyridine-1-carboxamide is sourced from PubChem (CID 89303380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).