C7H14O3S — CID 89303450
(2S,3S,5S)-3,5-bis(hydroxymethyl)-2-methylthiolan-3-ol (PubChem CID 89303450) has the molecular formula C7H14O3S and a molecular weight of 178.25 g/mol. Its IUPAC name is (2S,3S,5S)-3,5-bis(hydroxymethyl)-2-methylthiolan-3-ol.
| Compound Name | (2S,3S,5S)-3,5-bis(hydroxymethyl)-2-methylthiolan-3-ol |
|---|---|
| PubChem CID | 89303450 |
| Molecular Formula | C7H14O3S |
| Molecular Weight | 178.25 g/mol |
| Exact Mass | 178.07 |
| IUPAC Name | (2S,3S,5S)-3,5-bis(hydroxymethyl)-2-methylthiolan-3-ol |
| SMILES | C[C@@H]1S[C@H](CO)C[C@]1(O)CO |
| InChI | InChI=1S/C7H14O3S/c1-5-7(10,4-9)2-6(3-8)11-5/h5-6,8-10H,2-4H2,1H3/t5-,6-,7-/m0/s1 |
| InChIKey | ADBKCNZCUICVEW-ACZMJKKPSA-N |
| XLogP | -0.40 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.25 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |