C20H22Cl2N4O2 — CID 89303525
(2R)-1-N-(6-chloro-2-methyl-3-pyridinyl)-2-N-[(4-chlorophenyl)methyl]-2-N-methylpyrrolidine-1,2-dicarboxamide (PubChem CID 89303525) has the molecular formula C20H22Cl2N4O2 and a molecular weight of 421.33 g/mol. Its IUPAC name is (2R)-1-N-(6-chloro-2-methyl-3-pyridinyl)-2-N-[(4-chlorophenyl)methyl]-2-N-methylpyrrolidine-1,2-dicarboxamide.
| Compound Name | (2R)-1-N-(6-chloro-2-methyl-3-pyridinyl)-2-N-[(4-chlorophenyl)methyl]-2-N-methylpyrrolidine-1,2-dicarboxamide |
|---|---|
| PubChem CID | 89303525 |
| Molecular Formula | C20H22Cl2N4O2 |
| Molecular Weight | 421.33 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | (2R)-1-N-(6-chloro-2-methyl-3-pyridinyl)-2-N-[(4-chlorophenyl)methyl]-2-N-methylpyrrolidine-1,2-dicarboxamide |
| SMILES | Cc1nc(Cl)ccc1NC(=O)N1CCC[C@@H]1C(=O)N(C)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H22Cl2N4O2/c1-13-16(9-10-18(22)23-13)24-20(28)26-11-3-4-17(26)19(27)25(2)12-14-5-7-15(21)8-6-14/h5-10,17H,3-4,11-12H2,1-2H3,(H,24,28)/t17-/m1/s1 |
| InChIKey | UKQYVLYFTOHCDO-QGZVFWFLSA-N |
| XLogP | 4.35 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.33 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|