C31H28BrNO2 — CID 89303913
7-(1-bromobutyl)-11-ethyl-11,17-dimethyl-17-azahexacyclo[13.6.2.12,6.012,22.019,23.010,24]tetracosa-1(22),2,4,6,8,10(24),12,14,19(23),20-decaene-16,18-dione (PubChem CID 89303913) has the molecular formula C31H28BrNO2 and a molecular weight of 526.47 g/mol. Its IUPAC name is 7-(1-bromobutyl)-11-ethyl-11,17-dimethyl-17-azahexacyclo[13.6.2.12,6.012,22.019,23.010,24]tetracosa-1(22),2,4,6,8,10(24),12,14,19(23),20-decaene-16,18-dione.
| Compound Name | 7-(1-bromobutyl)-11-ethyl-11,17-dimethyl-17-azahexacyclo[13.6.2.12,6.012,22.019,23.010,24]tetracosa-1(22),2,4,6,8,10(24),12,14,19(23),20-decaene-16,18-dione |
|---|---|
| PubChem CID | 89303913 |
| Molecular Formula | C31H28BrNO2 |
| Molecular Weight | 526.47 g/mol |
| Exact Mass | 525.13 |
| IUPAC Name | 7-(1-bromobutyl)-11-ethyl-11,17-dimethyl-17-azahexacyclo[13.6.2.12,6.012,22.019,23.010,24]tetracosa-1(22),2,4,6,8,10(24),12,14,19(23),20-decaene-16,18-dione |
| SMILES | CCCC(Br)c1ccc2c3c(cccc13)-c1ccc3c4c(ccc(c14)C2(C)CC)C(=O)N(C)C3=O |
| InChI | InChI=1S/C31H28BrNO2/c1-5-8-25(32)17-13-15-23-26-18(17)9-7-10-19(26)20-11-12-21-27-22(30(35)33(4)29(21)34)14-16-24(28(20)27)31(23,3)6-2/h7,9-16,25H,5-6,8H2,1-4H3 |
| InChIKey | OATJMSMGKSCDGI-UHFFFAOYSA-N |
| XLogP | 8.15 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.47 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|