C30H22N2 — CID 89304024
3-(4-pyridin-3-ylphenyl)-4,5,10a,12b-tetrahydropyreno[1,2-b]pyridine (PubChem CID 89304024) has the molecular formula C30H22N2 and a molecular weight of 410.52 g/mol. Its IUPAC name is 3-(4-pyridin-3-ylphenyl)-4,5,10a,12b-tetrahydropyreno[1,2-b]pyridine.
| Compound Name | 3-(4-pyridin-3-ylphenyl)-4,5,10a,12b-tetrahydropyreno[1,2-b]pyridine |
|---|---|
| PubChem CID | 89304024 |
| Molecular Formula | C30H22N2 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | 3-(4-pyridin-3-ylphenyl)-4,5,10a,12b-tetrahydropyreno[1,2-b]pyridine |
| SMILES | C1=CC2=CC3=C4C(=CC=C5C=CC(c6ccc(-c7cccnc7)cc6)=C(CC3)C54)C2N=C1 |
| InChI | InChI=1S/C30H22N2/c1-4-24(18-31-15-1)19-5-7-20(8-6-19)25-12-9-21-10-14-27-29-22(11-13-26(25)28(21)29)17-23-3-2-16-32-30(23)27/h1-10,12,14-18,28,30H,11,13H2 |
| InChIKey | CPYFKXWZYCUQKN-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |