C23H23FINO4S — CID 89304077
(4aS,9R,10aS)-9-(4-fluorophenyl)sulfanyl-5,6-dihydroxy-4a-(iodomethyl)-2-methoxy-10-(methylamino)-4,9,10,10a-tetrahydrophenanthren-3-one (PubChem CID 89304077) has the molecular formula C23H23FINO4S and a molecular weight of 555.41 g/mol. Its IUPAC name is (4aS,9R,10aS)-9-(4-fluorophenyl)sulfanyl-5,6-dihydroxy-4a-(iodomethyl)-2-methoxy-10-(methylamino)-4,9,10,10a-tetrahydrophenanthren-3-one.
| Compound Name | (4aS,9R,10aS)-9-(4-fluorophenyl)sulfanyl-5,6-dihydroxy-4a-(iodomethyl)-2-methoxy-10-(methylamino)-4,9,10,10a-tetrahydrophenanthren-3-one |
|---|---|
| PubChem CID | 89304077 |
| Molecular Formula | C23H23FINO4S |
| Molecular Weight | 555.41 g/mol |
| Exact Mass | 555.04 |
| IUPAC Name | (4aS,9R,10aS)-9-(4-fluorophenyl)sulfanyl-5,6-dihydroxy-4a-(iodomethyl)-2-methoxy-10-(methylamino)-4,9,10,10a-tetrahydrophenanthren-3-one |
| SMILES | CNC1[C@H](Sc2ccc(F)cc2)c2ccc(O)c(O)c2[C@]2(CI)CC(=O)C(OC)=C[C@H]12 |
| InChI | InChI=1S/C23H23FINO4S/c1-26-20-15-9-18(30-2)17(28)10-23(15,11-25)19-14(7-8-16(27)21(19)29)22(20)31-13-5-3-12(24)4-6-13/h3-9,15,20,22,26-27,29H,10-11H2,1-2H3/t15-,20?,22-,23+/m1/s1 |
| InChIKey | YQKFLUWUUUULPQ-UZEIADEPSA-N |
| XLogP | 4.46 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.41 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|