C11H9F5O4S — CID 89304396
1,1,3,3,3-pentafluoro-2-(1-phenylethenoxy)propane-1-sulfonic acid (PubChem CID 89304396) has the molecular formula C11H9F5O4S and a molecular weight of 332.25 g/mol. Its IUPAC name is 1,1,3,3,3-pentafluoro-2-(1-phenylethenoxy)propane-1-sulfonic acid.
| Compound Name | 1,1,3,3,3-pentafluoro-2-(1-phenylethenoxy)propane-1-sulfonic acid |
|---|---|
| PubChem CID | 89304396 |
| Molecular Formula | C11H9F5O4S |
| Molecular Weight | 332.25 g/mol |
| Exact Mass | 332.01 |
| IUPAC Name | 1,1,3,3,3-pentafluoro-2-(1-phenylethenoxy)propane-1-sulfonic acid |
| SMILES | C=C(OC(C(F)(F)F)C(F)(F)S(=O)(=O)O)c1ccccc1 |
| InChI | InChI=1S/C11H9F5O4S/c1-7(8-5-3-2-4-6-8)20-9(10(12,13)14)11(15,16)21(17,18)19/h2-6,9H,1H2,(H,17,18,19) |
| InChIKey | SFGHVMLBSJLIJC-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.25 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|