C25H25N7O2S — CID 89304452
(2S,4R)-4-[7-amino-6-methylsulfonyl-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]-2-methylpiperidine-1-carbonitrile (PubChem CID 89304452) has the molecular formula C25H25N7O2S and a molecular weight of 487.59 g/mol. Its IUPAC name is (2S,4R)-4-[7-amino-6-methylsulfonyl-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]-2-methylpiperidine-1-carbonitrile.
| Compound Name | (2S,4R)-4-[7-amino-6-methylsulfonyl-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]-2-methylpiperidine-1-carbonitrile |
|---|---|
| PubChem CID | 89304452 |
| Molecular Formula | C25H25N7O2S |
| Molecular Weight | 487.59 g/mol |
| Exact Mass | 487.18 |
| IUPAC Name | (2S,4R)-4-[7-amino-6-methylsulfonyl-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]-2-methylpiperidine-1-carbonitrile |
| SMILES | C[C@H]1C[C@H](c2nc3c(-c4ccc(-c5ccccc5)nc4)cnn3c(N)c2S(C)(=O)=O)CCN1C#N |
| InChI | InChI=1S/C25H25N7O2S/c1-16-12-18(10-11-31(16)15-26)22-23(35(2,33)34)24(27)32-25(30-22)20(14-29-32)19-8-9-21(28-13-19)17-6-4-3-5-7-17/h3-9,13-14,16,18H,10-12,27H2,1-2H3/t16-,18+/m0/s1 |
| InChIKey | CVQSHEUTZBJZDS-FUHWJXTLSA-N |
| XLogP | 3.49 |
| TPSA | 130.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.59 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|