About 7,8-dihydrobenzo[g][1,4]benzodithiine-2,3-dithiol
7,8-dihydrobenzo[g][1,4]benzodithiine-2,3-dithiol (PubChem CID 89304573) has the molecular formula C12H10S4
and a molecular weight of 282.48 g/mol. Its IUPAC name is 7,8-dihydrobenzo[g][1,4]benzodithiine-2,3-dithiol.
Molecular Properties
| Compound Name | 7,8-dihydrobenzo[g][1,4]benzodithiine-2,3-dithiol |
| PubChem CID | 89304573 |
| Molecular Formula | C12H10S4 |
| Molecular Weight | 282.48 g/mol |
| Exact Mass | 281.97 |
| IUPAC Name | 7,8-dihydrobenzo[g][1,4]benzodithiine-2,3-dithiol |
| SMILES | SC1=C(S)Sc2cc3c(cc2S1)=CCCC=3 |
| InChI | InChI=1S/C12H10S4/c13-11-12(14)16-10-6-8-4-2-1-3-7(8)5-9(10)15-11/h3-6,13-14H,1-2H2 |
| InChIKey | LVCMTRYKVRDOPI-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.48 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 7,8-dihydrobenzo[g][1,4]benzodithiine-2,3-dithiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,8-dihydrobenzo[g][1,4]benzodithiine-2,3-dithiol?
The IUPAC name of 7,8-dihydrobenzo[g][1,4]benzodithiine-2,3-dithiol (CID 89304573) is 7,8-dihydrobenzo[g][1,4]benzodithiine-2,3-dithiol.
What is the SMILES notation for 7,8-dihydrobenzo[g][1,4]benzodithiine-2,3-dithiol?
The canonical SMILES for 7,8-dihydrobenzo[g][1,4]benzodithiine-2,3-dithiol is SC1=C(S)Sc2cc3c(cc2S1)=CCCC=3.
What is the InChIKey of 7,8-dihydrobenzo[g][1,4]benzodithiine-2,3-dithiol?
The InChIKey is LVCMTRYKVRDOPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10S4/c13-11-12(14)16-10-6-8-4-2-1-3-7(8)5-9(10)15-11/h3-6,13-14H,1-2H2.
What are the key properties of 7,8-dihydrobenzo[g][1,4]benzodithiine-2,3-dithiol?
7,8-dihydrobenzo[g][1,4]benzodithiine-2,3-dithiol has a molecular weight of 282.48 g/mol, XLogP of 3.23, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7,8-dihydrobenzo[g][1,4]benzodithiine-2,3-dithiol is sourced from PubChem (CID 89304573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).