C26H21F3N4 — CID 89304601
(3Z,5E)-6-[4-(diethylamino)phenyl]-2-[4-(trifluoromethyl)phenyl]hexa-1,3,5-triene-1,1,3-tricarbonitrile (PubChem CID 89304601) has the molecular formula C26H21F3N4 and a molecular weight of 446.48 g/mol. Its IUPAC name is (3Z,5E)-6-[4-(diethylamino)phenyl]-2-[4-(trifluoromethyl)phenyl]hexa-1,3,5-triene-1,1,3-tricarbonitrile.
| Compound Name | (3Z,5E)-6-[4-(diethylamino)phenyl]-2-[4-(trifluoromethyl)phenyl]hexa-1,3,5-triene-1,1,3-tricarbonitrile |
|---|---|
| PubChem CID | 89304601 |
| Molecular Formula | C26H21F3N4 |
| Molecular Weight | 446.48 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | (3Z,5E)-6-[4-(diethylamino)phenyl]-2-[4-(trifluoromethyl)phenyl]hexa-1,3,5-triene-1,1,3-tricarbonitrile |
| SMILES | CCN(CC)c1ccc(/C=C/C=C(\C#N)C(=C(C#N)C#N)c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C26H21F3N4/c1-3-33(4-2)24-14-8-19(9-15-24)6-5-7-21(16-30)25(22(17-31)18-32)20-10-12-23(13-11-20)26(27,28)29/h5-15H,3-4H2,1-2H3/b6-5+,21-7+ |
| InChIKey | OHWASLULBNWVMK-FZTLNYMGSA-N |
| XLogP | 6.52 |
| TPSA | 74.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.48 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|