C25H38N2 — CID 89304734
N-[(3Z,5E)-5-tert-butyl-2-methylidenehepta-3,5-dienyl]-1-[(Z,2E)-2-ethylidenehex-3-en-5-ynyl]piperidin-4-amine (PubChem CID 89304734) has the molecular formula C25H38N2 and a molecular weight of 366.59 g/mol. Its IUPAC name is N-[(3Z,5E)-5-tert-butyl-2-methylidenehepta-3,5-dienyl]-1-[(Z,2E)-2-ethylidenehex-3-en-5-ynyl]piperidin-4-amine.
| Compound Name | N-[(3Z,5E)-5-tert-butyl-2-methylidenehepta-3,5-dienyl]-1-[(Z,2E)-2-ethylidenehex-3-en-5-ynyl]piperidin-4-amine |
|---|---|
| PubChem CID | 89304734 |
| Molecular Formula | C25H38N2 |
| Molecular Weight | 366.59 g/mol |
| Exact Mass | 366.30 |
| IUPAC Name | N-[(3Z,5E)-5-tert-butyl-2-methylidenehepta-3,5-dienyl]-1-[(Z,2E)-2-ethylidenehex-3-en-5-ynyl]piperidin-4-amine |
| SMILES | C#C/C=C\C(=C/C)CN1CCC(NCC(=C)/C=C\C(=C/C)C(C)(C)C)CC1 |
| InChI | InChI=1S/C25H38N2/c1-8-11-12-22(9-2)20-27-17-15-24(16-18-27)26-19-21(4)13-14-23(10-3)25(5,6)7/h1,9-14,24,26H,4,15-20H2,2-3,5-7H3/b12-11-,14-13-,22-9+,23-10+ |
| InChIKey | CPVFNJJKSLAPLK-ISXXYWPISA-N |
| XLogP | 5.28 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.59 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|