C19H35NO3P+ — CID 89305113
[1-[tert-butyl(1-cyclohexa-1,3-dien-1-ylethoxy)amino]-2,2-dimethylpropyl]-ethoxy-oxophosphanium (PubChem CID 89305113) has the molecular formula C19H35NO3P+ and a molecular weight of 356.47 g/mol. Its IUPAC name is [1-[tert-butyl(1-cyclohexa-1,3-dien-1-ylethoxy)amino]-2,2-dimethylpropyl]-ethoxy-oxophosphanium.
| Compound Name | [1-[tert-butyl(1-cyclohexa-1,3-dien-1-ylethoxy)amino]-2,2-dimethylpropyl]-ethoxy-oxophosphanium |
|---|---|
| PubChem CID | 89305113 |
| Molecular Formula | C19H35NO3P+ |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.23 |
| IUPAC Name | [1-[tert-butyl(1-cyclohexa-1,3-dien-1-ylethoxy)amino]-2,2-dimethylpropyl]-ethoxy-oxophosphanium |
| SMILES | CCO[P+](=O)C(N(OC(C)C1=CC=CCC1)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C19H35NO3P/c1-9-22-24(21)17(18(3,4)5)20(19(6,7)8)23-15(2)16-13-11-10-12-14-16/h10-11,13,15,17H,9,12,14H2,1-8H3/q+1 |
| InChIKey | VMZCAYCKZLUKKX-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|