About (2R)-2-methyl-3,4-dihydro-2H-pyridine-1-carbaldehyde
(2R)-2-methyl-3,4-dihydro-2H-pyridine-1-carbaldehyde (PubChem CID 89305143) has the molecular formula C7H11NO
and a molecular weight of 125.17 g/mol. Its IUPAC name is (2R)-2-methyl-3,4-dihydro-2H-pyridine-1-carbaldehyde.
Molecular Properties
| Compound Name | (2R)-2-methyl-3,4-dihydro-2H-pyridine-1-carbaldehyde |
| PubChem CID | 89305143 |
| Molecular Formula | C7H11NO |
| Molecular Weight | 125.17 g/mol |
| Exact Mass | 125.08 |
| IUPAC Name | (2R)-2-methyl-3,4-dihydro-2H-pyridine-1-carbaldehyde |
| SMILES | C[C@@H]1CCC=CN1C=O |
| InChI | InChI=1S/C7H11NO/c1-7-4-2-3-5-8(7)6-9/h3,5-7H,2,4H2,1H3/t7-/m1/s1 |
| InChIKey | BZXYQLBHEAVJFK-SSDOTTSWSA-N |
| XLogP | 1.14 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.17 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2-methyl-3,4-dihydro-2H-pyridine-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-methyl-3,4-dihydro-2H-pyridine-1-carbaldehyde?
The IUPAC name of (2R)-2-methyl-3,4-dihydro-2H-pyridine-1-carbaldehyde (CID 89305143) is (2R)-2-methyl-3,4-dihydro-2H-pyridine-1-carbaldehyde.
What is the SMILES notation for (2R)-2-methyl-3,4-dihydro-2H-pyridine-1-carbaldehyde?
The canonical SMILES for (2R)-2-methyl-3,4-dihydro-2H-pyridine-1-carbaldehyde is C[C@@H]1CCC=CN1C=O.
What is the InChIKey of (2R)-2-methyl-3,4-dihydro-2H-pyridine-1-carbaldehyde?
The InChIKey is BZXYQLBHEAVJFK-SSDOTTSWSA-N. The full InChI is InChI=1S/C7H11NO/c1-7-4-2-3-5-8(7)6-9/h3,5-7H,2,4H2,1H3/t7-/m1/s1.
What are the key properties of (2R)-2-methyl-3,4-dihydro-2H-pyridine-1-carbaldehyde?
(2R)-2-methyl-3,4-dihydro-2H-pyridine-1-carbaldehyde has a molecular weight of 125.17 g/mol, XLogP of 1.14, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-methyl-3,4-dihydro-2H-pyridine-1-carbaldehyde is sourced from PubChem (CID 89305143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).