C11H5ClF6 — CID 89305706
1-(1-chloroethenyl)-2-[(Z)-1,2-difluoroprop-1-enyl]-3,4,5,6-tetrafluorobenzene (PubChem CID 89305706) has the molecular formula C11H5ClF6 and a molecular weight of 286.60 g/mol. Its IUPAC name is 1-(1-chloroethenyl)-2-[(Z)-1,2-difluoroprop-1-enyl]-3,4,5,6-tetrafluorobenzene.
| Compound Name | 1-(1-chloroethenyl)-2-[(Z)-1,2-difluoroprop-1-enyl]-3,4,5,6-tetrafluorobenzene |
|---|---|
| PubChem CID | 89305706 |
| Molecular Formula | C11H5ClF6 |
| Molecular Weight | 286.60 g/mol |
| Exact Mass | 286.00 |
| IUPAC Name | 1-(1-chloroethenyl)-2-[(Z)-1,2-difluoroprop-1-enyl]-3,4,5,6-tetrafluorobenzene |
| SMILES | C=C(Cl)c1c(F)c(F)c(F)c(F)c1/C(F)=C(\C)F |
| InChI | InChI=1S/C11H5ClF6/c1-3(12)5-6(7(14)4(2)13)9(16)11(18)10(17)8(5)15/h1H2,2H3/b7-4- |
| InChIKey | PSSCBFRHBMJKSN-DAXSKMNVSA-N |
| XLogP | 5.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.60 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|