About 4-methyl-6-propan-2-yl-2,3,4,5-tetrahydrothiepine
4-methyl-6-propan-2-yl-2,3,4,5-tetrahydrothiepine (PubChem CID 89305724) has the molecular formula C10H18S
and a molecular weight of 170.32 g/mol. Its IUPAC name is 4-methyl-6-propan-2-yl-2,3,4,5-tetrahydrothiepine.
Molecular Properties
| Compound Name | 4-methyl-6-propan-2-yl-2,3,4,5-tetrahydrothiepine |
| PubChem CID | 89305724 |
| Molecular Formula | C10H18S |
| Molecular Weight | 170.32 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | 4-methyl-6-propan-2-yl-2,3,4,5-tetrahydrothiepine |
| SMILES | CC1CCSC=C(C(C)C)C1 |
| InChI | InChI=1S/C10H18S/c1-8(2)10-6-9(3)4-5-11-7-10/h7-9H,4-6H2,1-3H3 |
| InChIKey | UWUVNNIEXXOVBM-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.32 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-methyl-6-propan-2-yl-2,3,4,5-tetrahydrothiepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-6-propan-2-yl-2,3,4,5-tetrahydrothiepine?
The IUPAC name of 4-methyl-6-propan-2-yl-2,3,4,5-tetrahydrothiepine (CID 89305724) is 4-methyl-6-propan-2-yl-2,3,4,5-tetrahydrothiepine.
What is the SMILES notation for 4-methyl-6-propan-2-yl-2,3,4,5-tetrahydrothiepine?
The canonical SMILES for 4-methyl-6-propan-2-yl-2,3,4,5-tetrahydrothiepine is CC1CCSC=C(C(C)C)C1.
What is the InChIKey of 4-methyl-6-propan-2-yl-2,3,4,5-tetrahydrothiepine?
The InChIKey is UWUVNNIEXXOVBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18S/c1-8(2)10-6-9(3)4-5-11-7-10/h7-9H,4-6H2,1-3H3.
What are the key properties of 4-methyl-6-propan-2-yl-2,3,4,5-tetrahydrothiepine?
4-methyl-6-propan-2-yl-2,3,4,5-tetrahydrothiepine has a molecular weight of 170.32 g/mol, XLogP of 3.69, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-6-propan-2-yl-2,3,4,5-tetrahydrothiepine is sourced from PubChem (CID 89305724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).