About (3-methyl-2,3-dihydro-1-benzothiophen-2-yl)methanol
(3-methyl-2,3-dihydro-1-benzothiophen-2-yl)methanol (PubChem CID 89305727) has the molecular formula C10H12OS
and a molecular weight of 180.27 g/mol. Its IUPAC name is (3-methyl-2,3-dihydro-1-benzothiophen-2-yl)methanol.
Molecular Properties
| Compound Name | (3-methyl-2,3-dihydro-1-benzothiophen-2-yl)methanol |
| PubChem CID | 89305727 |
| Molecular Formula | C10H12OS |
| Molecular Weight | 180.27 g/mol |
| Exact Mass | 180.06 |
| IUPAC Name | (3-methyl-2,3-dihydro-1-benzothiophen-2-yl)methanol |
| SMILES | CC1c2ccccc2SC1CO |
| InChI | InChI=1S/C10H12OS/c1-7-8-4-2-3-5-9(8)12-10(7)6-11/h2-5,7,10-11H,6H2,1H3 |
| InChIKey | GGLRLYJTSKBKLB-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.27 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3-methyl-2,3-dihydro-1-benzothiophen-2-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methyl-2,3-dihydro-1-benzothiophen-2-yl)methanol?
The IUPAC name of (3-methyl-2,3-dihydro-1-benzothiophen-2-yl)methanol (CID 89305727) is (3-methyl-2,3-dihydro-1-benzothiophen-2-yl)methanol.
What is the SMILES notation for (3-methyl-2,3-dihydro-1-benzothiophen-2-yl)methanol?
The canonical SMILES for (3-methyl-2,3-dihydro-1-benzothiophen-2-yl)methanol is CC1c2ccccc2SC1CO.
What is the InChIKey of (3-methyl-2,3-dihydro-1-benzothiophen-2-yl)methanol?
The InChIKey is GGLRLYJTSKBKLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12OS/c1-7-8-4-2-3-5-9(8)12-10(7)6-11/h2-5,7,10-11H,6H2,1H3.
What are the key properties of (3-methyl-2,3-dihydro-1-benzothiophen-2-yl)methanol?
(3-methyl-2,3-dihydro-1-benzothiophen-2-yl)methanol has a molecular weight of 180.27 g/mol, XLogP of 2.26, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methyl-2,3-dihydro-1-benzothiophen-2-yl)methanol is sourced from PubChem (CID 89305727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).