C22H24N2O5 — CID 89305740
3-[[2-[(2-cyclopropyl-3-propan-2-yl-2,3-dihydrofuran-5-yl)methylamino]-3,4-dioxocyclobuten-1-yl]amino]-2-hydroxybenzaldehyde (PubChem CID 89305740) has the molecular formula C22H24N2O5 and a molecular weight of 396.44 g/mol. Its IUPAC name is 3-[[2-[(2-cyclopropyl-3-propan-2-yl-2,3-dihydrofuran-5-yl)methylamino]-3,4-dioxocyclobuten-1-yl]amino]-2-hydroxybenzaldehyde.
| Compound Name | 3-[[2-[(2-cyclopropyl-3-propan-2-yl-2,3-dihydrofuran-5-yl)methylamino]-3,4-dioxocyclobuten-1-yl]amino]-2-hydroxybenzaldehyde |
|---|---|
| PubChem CID | 89305740 |
| Molecular Formula | C22H24N2O5 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | 3-[[2-[(2-cyclopropyl-3-propan-2-yl-2,3-dihydrofuran-5-yl)methylamino]-3,4-dioxocyclobuten-1-yl]amino]-2-hydroxybenzaldehyde |
| SMILES | CC(C)C1C=C(CNc2c(Nc3cccc(C=O)c3O)c(=O)c2=O)OC1C1CC1 |
| InChI | InChI=1S/C22H24N2O5/c1-11(2)15-8-14(29-22(15)12-6-7-12)9-23-17-18(21(28)20(17)27)24-16-5-3-4-13(10-25)19(16)26/h3-5,8,10-12,15,22-24,26H,6-7,9H2,1-2H3 |
| InChIKey | GWPCVIFMJWJSCX-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|