C22H18BN5OS — CID 89305752
CID 89305752 (PubChem CID 89305752) has the molecular formula C22H18BN5OS and a molecular weight of 411.30 g/mol.
| Compound Name | CID 89305752 |
|---|---|
| PubChem CID | 89305752 |
| Molecular Formula | C22H18BN5OS |
| Molecular Weight | 411.30 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(NC(=O)Nc2ccc(C)c(Nc3nc(-c4cccnc4)cs3)c2)cc1 |
| InChI | InChI=1S/C22H18BN5OS/c1-14-4-7-18(26-21(29)25-17-8-5-16(23)6-9-17)11-19(14)27-22-28-20(13-30-22)15-3-2-10-24-12-15/h2-13H,1H3,(H,27,28)(H2,25,26,29) |
| InChIKey | RJEFODMFVZNJQR-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 78.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.30 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|