C11H13F3N3O5S2- — CID 89305927
4-[(5,5-dimethyl-4H-1,2-oxazol-3-yl)sulfonylmethyl]-1-methyl-3-(trifluoromethyl)pyrazole-5-sulfinate (PubChem CID 89305927) has the molecular formula C11H13F3N3O5S2- and a molecular weight of 388.37 g/mol. Its IUPAC name is 4-[(5,5-dimethyl-4H-1,2-oxazol-3-yl)sulfonylmethyl]-1-methyl-3-(trifluoromethyl)pyrazole-5-sulfinate.
| Compound Name | 4-[(5,5-dimethyl-4H-1,2-oxazol-3-yl)sulfonylmethyl]-1-methyl-3-(trifluoromethyl)pyrazole-5-sulfinate |
|---|---|
| PubChem CID | 89305927 |
| Molecular Formula | C11H13F3N3O5S2- |
| Molecular Weight | 388.37 g/mol |
| Exact Mass | 388.03 |
| IUPAC Name | 4-[(5,5-dimethyl-4H-1,2-oxazol-3-yl)sulfonylmethyl]-1-methyl-3-(trifluoromethyl)pyrazole-5-sulfinate |
| SMILES | Cn1nc(C(F)(F)F)c(CS(=O)(=O)C2=NOC(C)(C)C2)c1S(=O)[O-] |
| InChI | InChI=1S/C11H14F3N3O5S2/c1-10(2)4-7(16-22-10)24(20,21)5-6-8(11(12,13)14)15-17(3)9(6)23(18)19/h4-5H2,1-3H3,(H,18,19)/p-1 |
| InChIKey | ZGUUXZMKESPNCQ-UHFFFAOYSA-M |
| XLogP | 1.10 |
| TPSA | 113.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.37 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|