About 6-(7-chloro-1H-pyrazolo[4,5-d]pyrimidin-5-yl)-4H-1,4-benzoxazin-3-one
6-(7-chloro-1H-pyrazolo[4,5-d]pyrimidin-5-yl)-4H-1,4-benzoxazin-3-one (PubChem CID 89306224) has the molecular formula C13H8ClN5O2
and a molecular weight of 301.69 g/mol. Its IUPAC name is 6-(7-chloro-1H-pyrazolo[4,5-d]pyrimidin-5-yl)-4H-1,4-benzoxazin-3-one.
Molecular Properties
| Compound Name | 6-(7-chloro-1H-pyrazolo[4,5-d]pyrimidin-5-yl)-4H-1,4-benzoxazin-3-one |
| PubChem CID | 89306224 |
| Molecular Formula | C13H8ClN5O2 |
| Molecular Weight | 301.69 g/mol |
| Exact Mass | 301.04 |
| IUPAC Name | 6-(7-chloro-1H-pyrazolo[4,5-d]pyrimidin-5-yl)-4H-1,4-benzoxazin-3-one |
| SMILES | O=C1COc2ccc(-c3nc(Cl)c4[nH]ncc4n3)cc2N1 |
| InChI | InChI=1S/C13H8ClN5O2/c14-12-11-8(4-15-19-11)17-13(18-12)6-1-2-9-7(3-6)16-10(20)5-21-9/h1-4H,5H2,(H,15,19)(H,16,20) |
| InChIKey | IUVUCZOULWGXBZ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.69 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-(7-chloro-1H-pyrazolo[4,5-d]pyrimidin-5-yl)-4H-1,4-benzoxazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(7-chloro-1H-pyrazolo[4,5-d]pyrimidin-5-yl)-4H-1,4-benzoxazin-3-one?
The IUPAC name of 6-(7-chloro-1H-pyrazolo[4,5-d]pyrimidin-5-yl)-4H-1,4-benzoxazin-3-one (CID 89306224) is 6-(7-chloro-1H-pyrazolo[4,5-d]pyrimidin-5-yl)-4H-1,4-benzoxazin-3-one.
What is the SMILES notation for 6-(7-chloro-1H-pyrazolo[4,5-d]pyrimidin-5-yl)-4H-1,4-benzoxazin-3-one?
The canonical SMILES for 6-(7-chloro-1H-pyrazolo[4,5-d]pyrimidin-5-yl)-4H-1,4-benzoxazin-3-one is O=C1COc2ccc(-c3nc(Cl)c4[nH]ncc4n3)cc2N1.
What is the InChIKey of 6-(7-chloro-1H-pyrazolo[4,5-d]pyrimidin-5-yl)-4H-1,4-benzoxazin-3-one?
The InChIKey is IUVUCZOULWGXBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8ClN5O2/c14-12-11-8(4-15-19-11)17-13(18-12)6-1-2-9-7(3-6)16-10(20)5-21-9/h1-4H,5H2,(H,15,19)(H,16,20).
What are the key properties of 6-(7-chloro-1H-pyrazolo[4,5-d]pyrimidin-5-yl)-4H-1,4-benzoxazin-3-one?
6-(7-chloro-1H-pyrazolo[4,5-d]pyrimidin-5-yl)-4H-1,4-benzoxazin-3-one has a molecular weight of 301.69 g/mol, XLogP of 2.00, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(7-chloro-1H-pyrazolo[4,5-d]pyrimidin-5-yl)-4H-1,4-benzoxazin-3-one is sourced from PubChem (CID 89306224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).