About 2-methyl-2-propyl-1,3,6-trioxocane
2-methyl-2-propyl-1,3,6-trioxocane (PubChem CID 89306416) has the molecular formula C9H18O3
and a molecular weight of 174.24 g/mol. Its IUPAC name is 2-methyl-2-propyl-1,3,6-trioxocane.
Molecular Properties
| Compound Name | 2-methyl-2-propyl-1,3,6-trioxocane |
| PubChem CID | 89306416 |
| Molecular Formula | C9H18O3 |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.13 |
| IUPAC Name | 2-methyl-2-propyl-1,3,6-trioxocane |
| SMILES | CCCC1(C)OCCOCCO1 |
| InChI | InChI=1S/C9H18O3/c1-3-4-9(2)11-7-5-10-6-8-12-9/h3-8H2,1-2H3 |
| InChIKey | JUJDPDZZQJZELQ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methyl-2-propyl-1,3,6-trioxocane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-2-propyl-1,3,6-trioxocane?
The IUPAC name of 2-methyl-2-propyl-1,3,6-trioxocane (CID 89306416) is 2-methyl-2-propyl-1,3,6-trioxocane.
What is the SMILES notation for 2-methyl-2-propyl-1,3,6-trioxocane?
The canonical SMILES for 2-methyl-2-propyl-1,3,6-trioxocane is CCCC1(C)OCCOCCO1.
What is the InChIKey of 2-methyl-2-propyl-1,3,6-trioxocane?
The InChIKey is JUJDPDZZQJZELQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18O3/c1-3-4-9(2)11-7-5-10-6-8-12-9/h3-8H2,1-2H3.
What are the key properties of 2-methyl-2-propyl-1,3,6-trioxocane?
2-methyl-2-propyl-1,3,6-trioxocane has a molecular weight of 174.24 g/mol, XLogP of 1.57, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-2-propyl-1,3,6-trioxocane is sourced from PubChem (CID 89306416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).