About [(4-methylphenyl)-diphenyl-λ4-sulfanyl] 1,1-difluoro-2-hydroxyethanesulfonate
[(4-methylphenyl)-diphenyl-λ4-sulfanyl] 1,1-difluoro-2-hydroxyethanesulfonate (PubChem CID 89306622) has the molecular formula C21H20F2O4S2
and a molecular weight of 438.52 g/mol. Its IUPAC name is [(4-methylphenyl)-diphenyl-λ4-sulfanyl] 1,1-difluoro-2-hydroxyethanesulfonate.
Molecular Properties
| Compound Name | [(4-methylphenyl)-diphenyl-λ4-sulfanyl] 1,1-difluoro-2-hydroxyethanesulfonate |
| PubChem CID | 89306622 |
| Molecular Formula | C21H20F2O4S2 |
| Molecular Weight | 438.52 g/mol |
| Exact Mass | 438.08 |
| IUPAC Name | [(4-methylphenyl)-diphenyl-λ4-sulfanyl] 1,1-difluoro-2-hydroxyethanesulfonate |
| SMILES | Cc1ccc(S(OS(=O)(=O)C(F)(F)CO)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H20F2O4S2/c1-17-12-14-20(15-13-17)28(18-8-4-2-5-9-18,19-10-6-3-7-11-19)27-29(25,26)21(22,23)16-24/h2-15,24H,16H2,1H3 |
| InChIKey | ZNGLWCGLGRBZSL-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 438.52 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(4-methylphenyl)-diphenyl-λ4-sulfanyl] 1,1-difluoro-2-hydroxyethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4-methylphenyl)-diphenyl-λ4-sulfanyl] 1,1-difluoro-2-hydroxyethanesulfonate?
The IUPAC name of [(4-methylphenyl)-diphenyl-λ4-sulfanyl] 1,1-difluoro-2-hydroxyethanesulfonate (CID 89306622) is [(4-methylphenyl)-diphenyl-λ4-sulfanyl] 1,1-difluoro-2-hydroxyethanesulfonate.
What is the SMILES notation for [(4-methylphenyl)-diphenyl-λ4-sulfanyl] 1,1-difluoro-2-hydroxyethanesulfonate?
The canonical SMILES for [(4-methylphenyl)-diphenyl-λ4-sulfanyl] 1,1-difluoro-2-hydroxyethanesulfonate is Cc1ccc(S(OS(=O)(=O)C(F)(F)CO)(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of [(4-methylphenyl)-diphenyl-λ4-sulfanyl] 1,1-difluoro-2-hydroxyethanesulfonate?
The InChIKey is ZNGLWCGLGRBZSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20F2O4S2/c1-17-12-14-20(15-13-17)28(18-8-4-2-5-9-18,19-10-6-3-7-11-19)27-29(25,26)21(22,23)16-24/h2-15,24H,16H2,1H3.
What are the key properties of [(4-methylphenyl)-diphenyl-λ4-sulfanyl] 1,1-difluoro-2-hydroxyethanesulfonate?
[(4-methylphenyl)-diphenyl-λ4-sulfanyl] 1,1-difluoro-2-hydroxyethanesulfonate has a molecular weight of 438.52 g/mol, XLogP of 5.12, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(4-methylphenyl)-diphenyl-λ4-sulfanyl] 1,1-difluoro-2-hydroxyethanesulfonate is sourced from PubChem (CID 89306622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).