About (7S)-7-methoxy-2,6,6-trimethyloct-2-ene
(7S)-7-methoxy-2,6,6-trimethyloct-2-ene (PubChem CID 89306698) has the molecular formula C12H24O
and a molecular weight of 184.32 g/mol. Its IUPAC name is (7S)-7-methoxy-2,6,6-trimethyloct-2-ene.
Molecular Properties
| Compound Name | (7S)-7-methoxy-2,6,6-trimethyloct-2-ene |
| PubChem CID | 89306698 |
| Molecular Formula | C12H24O |
| Molecular Weight | 184.32 g/mol |
| Exact Mass | 184.18 |
| IUPAC Name | (7S)-7-methoxy-2,6,6-trimethyloct-2-ene |
| SMILES | CO[C@@H](C)C(C)(C)CCC=C(C)C |
| InChI | InChI=1S/C12H24O/c1-10(2)8-7-9-12(4,5)11(3)13-6/h8,11H,7,9H2,1-6H3/t11-/m0/s1 |
| InChIKey | KPSRGRWJWHCTCD-NSHDSACASA-N |
| XLogP | 3.79 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.32 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (7S)-7-methoxy-2,6,6-trimethyloct-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7S)-7-methoxy-2,6,6-trimethyloct-2-ene?
The IUPAC name of (7S)-7-methoxy-2,6,6-trimethyloct-2-ene (CID 89306698) is (7S)-7-methoxy-2,6,6-trimethyloct-2-ene.
What is the SMILES notation for (7S)-7-methoxy-2,6,6-trimethyloct-2-ene?
The canonical SMILES for (7S)-7-methoxy-2,6,6-trimethyloct-2-ene is CO[C@@H](C)C(C)(C)CCC=C(C)C.
What is the InChIKey of (7S)-7-methoxy-2,6,6-trimethyloct-2-ene?
The InChIKey is KPSRGRWJWHCTCD-NSHDSACASA-N. The full InChI is InChI=1S/C12H24O/c1-10(2)8-7-9-12(4,5)11(3)13-6/h8,11H,7,9H2,1-6H3/t11-/m0/s1.
What are the key properties of (7S)-7-methoxy-2,6,6-trimethyloct-2-ene?
(7S)-7-methoxy-2,6,6-trimethyloct-2-ene has a molecular weight of 184.32 g/mol, XLogP of 3.79, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (7S)-7-methoxy-2,6,6-trimethyloct-2-ene is sourced from PubChem (CID 89306698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).