C11H17NO — CID 89307445
(NE)-N-[(4E,7Z)-4-methyl-6-methylidenenona-4,7-dien-3-ylidene]hydroxylamine (PubChem CID 89307445) has the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. Its IUPAC name is (NE)-N-[(4E,7Z)-4-methyl-6-methylidenenona-4,7-dien-3-ylidene]hydroxylamine.
| Compound Name | (NE)-N-[(4E,7Z)-4-methyl-6-methylidenenona-4,7-dien-3-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 89307445 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | (NE)-N-[(4E,7Z)-4-methyl-6-methylidenenona-4,7-dien-3-ylidene]hydroxylamine |
| SMILES | C=C(/C=C\C)/C=C(C)/C(CC)=N/O |
| InChI | InChI=1S/C11H17NO/c1-5-7-9(3)8-10(4)11(6-2)12-13/h5,7-8,13H,3,6H2,1-2,4H3/b7-5-,10-8+,12-11+ |
| InChIKey | YXKTWFXQQRVNRC-QRGLPQAOSA-N |
| XLogP | 3.31 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|