C14H8Cl3N5O2 — CID 89307540
2,4,5-trichloro-6-[(4,6-dimethoxypyrimidin-2-yl)amino]benzene-1,3-dicarbonitrile (PubChem CID 89307540) has the molecular formula C14H8Cl3N5O2 and a molecular weight of 384.61 g/mol. Its IUPAC name is 2,4,5-trichloro-6-[(4,6-dimethoxypyrimidin-2-yl)amino]benzene-1,3-dicarbonitrile.
| Compound Name | 2,4,5-trichloro-6-[(4,6-dimethoxypyrimidin-2-yl)amino]benzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 89307540 |
| Molecular Formula | C14H8Cl3N5O2 |
| Molecular Weight | 384.61 g/mol |
| Exact Mass | 382.97 |
| IUPAC Name | 2,4,5-trichloro-6-[(4,6-dimethoxypyrimidin-2-yl)amino]benzene-1,3-dicarbonitrile |
| SMILES | COc1cc(OC)nc(Nc2c(Cl)c(Cl)c(C#N)c(Cl)c2C#N)n1 |
| InChI | InChI=1S/C14H8Cl3N5O2/c1-23-8-3-9(24-2)21-14(20-8)22-13-7(5-19)10(15)6(4-18)11(16)12(13)17/h3H,1-2H3,(H,20,21,22) |
| InChIKey | ILQILWVNOQIVCN-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 103.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.61 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|