C51H51BN6O12S — CID 89307786
CID 89307786 (PubChem CID 89307786) has the molecular formula C51H51BN6O12S and a molecular weight of 982.88 g/mol.
| Compound Name | CID 89307786 |
|---|---|
| PubChem CID | 89307786 |
| Molecular Formula | C51H51BN6O12S |
| Molecular Weight | 982.88 g/mol |
| Exact Mass | 982.34 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(C[C@H]2NC(=O)[C@H](Cc3cccs3)NC(=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)C(=O)Nc3ccc(cc3)C[C@H](C(=O)N[C@@H](Cc3ccccc3)C(=O)O)NC(=O)[C@H](Cc3ccccc3)NC2=O)cc1 |
| InChI | InChI=1S/C51H51BN6O12S/c1-29(59)69-43-44(70-30(2)60)50(66)57-41(28-37-14-9-23-71-37)48(64)56-39(25-33-15-19-35(52)20-16-33)46(62)54-38(24-31-10-5-3-6-11-31)45(61)55-40(26-34-17-21-36(22-18-34)53-49(43)65)47(63)58-42(51(67)68)27-32-12-7-4-8-13-32/h3-23,38-44H,24-28H2,1-2H3,(H,53,65)(H,54,62)(H,55,61)(H,56,64)(H,57,66)(H,58,63)(H,67,68)/t38-,39+,40+,41-,42-,43+,44+/m0/s1 |
| InChIKey | FMHCUKVPPJURJR-RBGSVQRDSA-N |
| XLogP | 1.38 |
| TPSA | 264.50 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 71 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 982.88 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'crown_ether', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|